C12H15NO — CID 83376428
8-methyl-2,3,5,6,7,8-hexahydrofuro[3,2-g]isoquinoline (PubChem CID 83376428) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 8-methyl-2,3,5,6,7,8-hexahydrofuro[3,2-g]isoquinoline.
| Compound Name | 8-methyl-2,3,5,6,7,8-hexahydrofuro[3,2-g]isoquinoline |
|---|---|
| PubChem CID | 83376428 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 8-methyl-2,3,5,6,7,8-hexahydrofuro[3,2-g]isoquinoline |
| SMILES | CC1NCCc2cc3c(cc21)OCC3 |
| InChI | InChI=1S/C12H15NO/c1-8-11-7-12-10(3-5-14-12)6-9(11)2-4-13-8/h6-8,13H,2-5H2,1H3 |
| InChIKey | LEKWKAKJSZPYFZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |