C14H21NO2 — CID 7157327
(1S)-6,7-diethoxy-1-methyl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 7157327) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is (1S)-6,7-diethoxy-1-methyl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | (1S)-6,7-diethoxy-1-methyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 7157327 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | (1S)-6,7-diethoxy-1-methyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | CCOc1cc2c(cc1OCC)[C@H](C)NCC2 |
| InChI | InChI=1S/C14H21NO2/c1-4-16-13-8-11-6-7-15-10(3)12(11)9-14(13)17-5-2/h8-10,15H,4-7H2,1-3H3/t10-/m0/s1 |
| InChIKey | WZKQNIZMVKPAPR-JTQLQIEISA-N |
| XLogP | 2.69 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |