C19H23NO3 — CID 674048
2-[(1S)-6,7-diethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]phenol (PubChem CID 674048) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is 2-[(1S)-6,7-diethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]phenol.
| Compound Name | 2-[(1S)-6,7-diethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]phenol |
|---|---|
| PubChem CID | 674048 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 2-[(1S)-6,7-diethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]phenol |
| SMILES | CCOc1cc2c(cc1OCC)[C@@H](c1ccccc1O)NCC2 |
| InChI | InChI=1S/C19H23NO3/c1-3-22-17-11-13-9-10-20-19(14-7-5-6-8-16(14)21)15(13)12-18(17)23-4-2/h5-8,11-12,19-21H,3-4,9-10H2,1-2H3/t19-/m1/s1 |
| InChIKey | PNAGXZKDAYOFFI-LJQANCHMSA-N |
| XLogP | 3.42 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|