C13H21FN2O — CID 145383424
5-(1-fluoropropan-2-yl)-1-methyl-1,2,3,4-tetrahydroisoquinoline;hydroxylamine (PubChem CID 145383424) has the molecular formula C13H21FN2O and a molecular weight of 240.32 g/mol. Its IUPAC name is 5-(1-fluoropropan-2-yl)-1-methyl-1,2,3,4-tetrahydroisoquinoline;hydroxylamine.
| Compound Name | 5-(1-fluoropropan-2-yl)-1-methyl-1,2,3,4-tetrahydroisoquinoline;hydroxylamine |
|---|---|
| PubChem CID | 145383424 |
| Molecular Formula | C13H21FN2O |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 5-(1-fluoropropan-2-yl)-1-methyl-1,2,3,4-tetrahydroisoquinoline;hydroxylamine |
| SMILES | CC(CF)c1cccc2c1CCNC2C.NO |
| InChI | InChI=1S/C13H18FN.H3NO/c1-9(8-14)11-4-3-5-12-10(2)15-7-6-13(11)12;1-2/h3-5,9-10,15H,6-8H2,1-2H3;2H,1H2 |
| InChIKey | ILJOPWAVWOMDFU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|