C12H13ClN2O2 — CID 86600498
4-nitro-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine;hydrochloride (PubChem CID 86600498) has the molecular formula C12H13ClN2O2 and a molecular weight of 252.70 g/mol. Its IUPAC name is 4-nitro-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine;hydrochloride.
| Compound Name | 4-nitro-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine;hydrochloride |
|---|---|
| PubChem CID | 86600498 |
| Molecular Formula | C12H13ClN2O2 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 4-nitro-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| SMILES | C#CCNC1CCc2c1cccc2[N+](=O)[O-].Cl |
| InChI | InChI=1S/C12H12N2O2.ClH/c1-2-8-13-11-7-6-10-9(11)4-3-5-12(10)14(15)16;/h1,3-5,11,13H,6-8H2;1H |
| InChIKey | CTLXILVJQXRLCY-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|