C13H13Br2NO2 — CID 89063950
1-(1,1-dibromoprop-1-en-2-yl)-5-nitro-1,2,3,4-tetrahydronaphthalene (PubChem CID 89063950) has the molecular formula C13H13Br2NO2 and a molecular weight of 375.06 g/mol. Its IUPAC name is 1-(1,1-dibromoprop-1-en-2-yl)-5-nitro-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1-(1,1-dibromoprop-1-en-2-yl)-5-nitro-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 89063950 |
| Molecular Formula | C13H13Br2NO2 |
| Molecular Weight | 375.06 g/mol |
| Exact Mass | 372.93 |
| IUPAC Name | 1-(1,1-dibromoprop-1-en-2-yl)-5-nitro-1,2,3,4-tetrahydronaphthalene |
| SMILES | CC(=C(Br)Br)C1CCCc2c1cccc2[N+](=O)[O-] |
| InChI | InChI=1S/C13H13Br2NO2/c1-8(13(14)15)9-4-2-6-11-10(9)5-3-7-12(11)16(17)18/h3,5,7,9H,2,4,6H2,1H3 |
| InChIKey | BOGLWQOCGITGCC-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.06 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|