C16H20N2O5S — CID 67627619
(2S)-4-methylsulfanyl-2-[(5-nitro-1,2,3,4-tetrahydronaphthalene-1-carbonyl)amino]butanoic acid (PubChem CID 67627619) has the molecular formula C16H20N2O5S and a molecular weight of 352.41 g/mol. Its IUPAC name is (2S)-4-methylsulfanyl-2-[(5-nitro-1,2,3,4-tetrahydronaphthalene-1-carbonyl)amino]butanoic acid.
| Compound Name | (2S)-4-methylsulfanyl-2-[(5-nitro-1,2,3,4-tetrahydronaphthalene-1-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 67627619 |
| Molecular Formula | C16H20N2O5S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | (2S)-4-methylsulfanyl-2-[(5-nitro-1,2,3,4-tetrahydronaphthalene-1-carbonyl)amino]butanoic acid |
| SMILES | CSCC[C@H](NC(=O)C1CCCc2c1cccc2[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C16H20N2O5S/c1-24-9-8-13(16(20)21)17-15(19)12-6-2-5-11-10(12)4-3-7-14(11)18(22)23/h3-4,7,12-13H,2,5-6,8-9H2,1H3,(H,17,19)(H,20,21)/t12?,13-/m0/s1 |
| InChIKey | YVDDVIRATMGIHQ-ABLWVSNPSA-N |
| XLogP | 2.34 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|