C12H15N3O5S — CID 43103608
4-methylsulfanyl-2-[(3-nitrophenyl)carbamoylamino]butanoic acid (PubChem CID 43103608) has the molecular formula C12H15N3O5S and a molecular weight of 313.34 g/mol. Its IUPAC name is 4-methylsulfanyl-2-[(3-nitrophenyl)carbamoylamino]butanoic acid.
| Compound Name | 4-methylsulfanyl-2-[(3-nitrophenyl)carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 43103608 |
| Molecular Formula | C12H15N3O5S |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 4-methylsulfanyl-2-[(3-nitrophenyl)carbamoylamino]butanoic acid |
| SMILES | CSCCC(NC(=O)Nc1cccc([N+](=O)[O-])c1)C(=O)O |
| InChI | InChI=1S/C12H15N3O5S/c1-21-6-5-10(11(16)17)14-12(18)13-8-3-2-4-9(7-8)15(19)20/h2-4,7,10H,5-6H2,1H3,(H,16,17)(H2,13,14,18) |
| InChIKey | RAYLZYYSJXHNGT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|