C17H18N6O3S — CID 40898654
1-[(1R)-3-methylsulfanyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-3-(3-nitrophenyl)urea (PubChem CID 40898654) has the molecular formula C17H18N6O3S and a molecular weight of 386.44 g/mol. Its IUPAC name is 1-[(1R)-3-methylsulfanyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-3-(3-nitrophenyl)urea.
| Compound Name | 1-[(1R)-3-methylsulfanyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-3-(3-nitrophenyl)urea |
|---|---|
| PubChem CID | 40898654 |
| Molecular Formula | C17H18N6O3S |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 1-[(1R)-3-methylsulfanyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-3-(3-nitrophenyl)urea |
| SMILES | CSCC[C@@H](NC(=O)Nc1cccc([N+](=O)[O-])c1)c1nnc2ccccn12 |
| InChI | InChI=1S/C17H18N6O3S/c1-27-10-8-14(16-21-20-15-7-2-3-9-22(15)16)19-17(24)18-12-5-4-6-13(11-12)23(25)26/h2-7,9,11,14H,8,10H2,1H3,(H2,18,19,24)/t14-/m1/s1 |
| InChIKey | GUZZRWVJLFQCNJ-CQSZACIVSA-N |
| XLogP | 3.25 |
| TPSA | 114.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|