C12H13Cl3N4OS — CID 23474192
2,2,2-trichloro-N-[3-methylsulfanyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]acetamide (PubChem CID 23474192) has the molecular formula C12H13Cl3N4OS and a molecular weight of 367.69 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[3-methylsulfanyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[3-methylsulfanyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]acetamide |
|---|---|
| PubChem CID | 23474192 |
| Molecular Formula | C12H13Cl3N4OS |
| Molecular Weight | 367.69 g/mol |
| Exact Mass | 365.99 |
| IUPAC Name | 2,2,2-trichloro-N-[3-methylsulfanyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]acetamide |
| SMILES | CSCCC(NC(=O)C(Cl)(Cl)Cl)c1nnc2ccccn12 |
| InChI | InChI=1S/C12H13Cl3N4OS/c1-21-7-5-8(16-11(20)12(13,14)15)10-18-17-9-4-2-3-6-19(9)10/h2-4,6,8H,5,7H2,1H3,(H,16,20) |
| InChIKey | BHSPKTBFCVYTTJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.69 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|