C18H23Cl2N5OS — CID 119837153
2-(4-aminophenyl)-N-[3-methylsulfanyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]acetamide;dihydrochloride (PubChem CID 119837153) has the molecular formula C18H23Cl2N5OS and a molecular weight of 428.39 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-[3-methylsulfanyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]acetamide;dihydrochloride.
| Compound Name | 2-(4-aminophenyl)-N-[3-methylsulfanyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119837153 |
| Molecular Formula | C18H23Cl2N5OS |
| Molecular Weight | 428.39 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 2-(4-aminophenyl)-N-[3-methylsulfanyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]acetamide;dihydrochloride |
| SMILES | CSCCC(NC(=O)Cc1ccc(N)cc1)c1nnc2ccccn12.Cl.Cl |
| InChI | InChI=1S/C18H21N5OS.2ClH/c1-25-11-9-15(18-22-21-16-4-2-3-10-23(16)18)20-17(24)12-13-5-7-14(19)8-6-13;;/h2-8,10,15H,9,11-12,19H2,1H3,(H,20,24);2*1H |
| InChIKey | QNVSSHHCHAZZFO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 85.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|