C22H26N4OS — CID 51268673
N-[3-methylsulfanyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetamide (PubChem CID 51268673) has the molecular formula C22H26N4OS and a molecular weight of 394.54 g/mol. Its IUPAC name is N-[3-methylsulfanyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetamide.
| Compound Name | N-[3-methylsulfanyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetamide |
|---|---|
| PubChem CID | 51268673 |
| Molecular Formula | C22H26N4OS |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | N-[3-methylsulfanyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetamide |
| SMILES | CSCCC(NC(=O)Cc1ccc2c(c1)CCCC2)c1nnc2ccccn12 |
| InChI | InChI=1S/C22H26N4OS/c1-28-13-11-19(22-25-24-20-8-4-5-12-26(20)22)23-21(27)15-16-9-10-17-6-2-3-7-18(17)14-16/h4-5,8-10,12,14,19H,2-3,6-7,11,13,15H2,1H3,(H,23,27) |
| InChIKey | KGEYYIQBECRDEI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |