C15H23N5OS — CID 119837156
4-(methylamino)-N-[3-methylsulfanyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]butanamide (PubChem CID 119837156) has the molecular formula C15H23N5OS and a molecular weight of 321.45 g/mol. Its IUPAC name is 4-(methylamino)-N-[3-methylsulfanyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]butanamide.
| Compound Name | 4-(methylamino)-N-[3-methylsulfanyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]butanamide |
|---|---|
| PubChem CID | 119837156 |
| Molecular Formula | C15H23N5OS |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 4-(methylamino)-N-[3-methylsulfanyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]butanamide |
| SMILES | CNCCCC(=O)NC(CCSC)c1nnc2ccccn12 |
| InChI | InChI=1S/C15H23N5OS/c1-16-9-5-7-14(21)17-12(8-11-22-2)15-19-18-13-6-3-4-10-20(13)15/h3-4,6,10,12,16H,5,7-9,11H2,1-2H3,(H,17,21) |
| InChIKey | RTCHJIVRMOUYID-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 71.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|