C21H23N7O2S — CID 71828310
N-[(1S)-3-methylsulfanyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-4-(4-oxo-1,2,3-benzotriazin-3-yl)butanamide (PubChem CID 71828310) has the molecular formula C21H23N7O2S and a molecular weight of 437.53 g/mol. Its IUPAC name is N-[(1S)-3-methylsulfanyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-4-(4-oxo-1,2,3-benzotriazin-3-yl)butanamide.
| Compound Name | N-[(1S)-3-methylsulfanyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-4-(4-oxo-1,2,3-benzotriazin-3-yl)butanamide |
|---|---|
| PubChem CID | 71828310 |
| Molecular Formula | C21H23N7O2S |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | N-[(1S)-3-methylsulfanyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-4-(4-oxo-1,2,3-benzotriazin-3-yl)butanamide |
| SMILES | CSCC[C@H](NC(=O)CCCn1nnc2ccccc2c1=O)c1nnc2ccccn12 |
| InChI | InChI=1S/C21H23N7O2S/c1-31-14-11-17(20-25-24-18-9-4-5-12-27(18)20)22-19(29)10-6-13-28-21(30)15-7-2-3-8-16(15)23-26-28/h2-5,7-9,12,17H,6,10-11,13-14H2,1H3,(H,22,29)/t17-/m0/s1 |
| InChIKey | UCNFAIRCCLKVRQ-KRWDZBQOSA-N |
| XLogP | 2.22 |
| TPSA | 107.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |