C21H32N6O2S — CID 55537152
4-(cyclohexylcarbamoylamino)-N-[3-methylsulfanyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]butanamide (PubChem CID 55537152) has the molecular formula C21H32N6O2S and a molecular weight of 432.59 g/mol. Its IUPAC name is 4-(cyclohexylcarbamoylamino)-N-[3-methylsulfanyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]butanamide.
| Compound Name | 4-(cyclohexylcarbamoylamino)-N-[3-methylsulfanyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]butanamide |
|---|---|
| PubChem CID | 55537152 |
| Molecular Formula | C21H32N6O2S |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 4-(cyclohexylcarbamoylamino)-N-[3-methylsulfanyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]butanamide |
| SMILES | CSCCC(NC(=O)CCCNC(=O)NC1CCCCC1)c1nnc2ccccn12 |
| InChI | InChI=1S/C21H32N6O2S/c1-30-15-12-17(20-26-25-18-10-5-6-14-27(18)20)24-19(28)11-7-13-22-21(29)23-16-8-3-2-4-9-16/h5-6,10,14,16-17H,2-4,7-9,11-13,15H2,1H3,(H,24,28)(H2,22,23,29) |
| InChIKey | PIEZOYFRARBNGK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 100.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|