C19H19N5O5S — CID 42921448
methyl 3-[[3-methylsulfanyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]carbamoyl]-5-nitrobenzoate (PubChem CID 42921448) has the molecular formula C19H19N5O5S and a molecular weight of 429.46 g/mol. Its IUPAC name is methyl 3-[[3-methylsulfanyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]carbamoyl]-5-nitrobenzoate.
| Compound Name | methyl 3-[[3-methylsulfanyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]carbamoyl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 42921448 |
| Molecular Formula | C19H19N5O5S |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | methyl 3-[[3-methylsulfanyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]carbamoyl]-5-nitrobenzoate |
| SMILES | COC(=O)c1cc(C(=O)NC(CCSC)c2nnc3ccccn23)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H19N5O5S/c1-29-19(26)13-9-12(10-14(11-13)24(27)28)18(25)20-15(6-8-30-2)17-22-21-16-5-3-4-7-23(16)17/h3-5,7,9-11,15H,6,8H2,1-2H3,(H,20,25) |
| InChIKey | NFYXDIUUNBHEBW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 128.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|