C12H14BrN2O3S- — CID 7680245
(2R)-2-[(3-bromophenyl)carbamoylamino]-4-methylsulfanylbutanoate (PubChem CID 7680245) has the molecular formula C12H14BrN2O3S- and a molecular weight of 346.23 g/mol. Its IUPAC name is (2R)-2-[(3-bromophenyl)carbamoylamino]-4-methylsulfanylbutanoate.
| Compound Name | (2R)-2-[(3-bromophenyl)carbamoylamino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 7680245 |
| Molecular Formula | C12H14BrN2O3S- |
| Molecular Weight | 346.23 g/mol |
| Exact Mass | 344.99 |
| IUPAC Name | (2R)-2-[(3-bromophenyl)carbamoylamino]-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@@H](NC(=O)Nc1cccc(Br)c1)C(=O)[O-] |
| InChI | InChI=1S/C12H15BrN2O3S/c1-19-6-5-10(11(16)17)15-12(18)14-9-4-2-3-8(13)7-9/h2-4,7,10H,5-6H2,1H3,(H,16,17)(H2,14,15,18)/p-1/t10-/m1/s1 |
| InChIKey | SDSJJHMDWRUECH-SNVBAGLBSA-M |
| XLogP | 1.44 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.23 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |