C13H14F3N2O3S- — CID 2022284
(2S)-4-methylsulfanyl-2-[[3-(trifluoromethyl)phenyl]carbamoylamino]butanoate (PubChem CID 2022284) has the molecular formula C13H14F3N2O3S- and a molecular weight of 335.33 g/mol. Its IUPAC name is (2S)-4-methylsulfanyl-2-[[3-(trifluoromethyl)phenyl]carbamoylamino]butanoate.
| Compound Name | (2S)-4-methylsulfanyl-2-[[3-(trifluoromethyl)phenyl]carbamoylamino]butanoate |
|---|---|
| PubChem CID | 2022284 |
| Molecular Formula | C13H14F3N2O3S- |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | (2S)-4-methylsulfanyl-2-[[3-(trifluoromethyl)phenyl]carbamoylamino]butanoate |
| SMILES | CSCC[C@H](NC(=O)Nc1cccc(C(F)(F)F)c1)C(=O)[O-] |
| InChI | InChI=1S/C13H15F3N2O3S/c1-22-6-5-10(11(19)20)18-12(21)17-9-4-2-3-8(7-9)13(14,15)16/h2-4,7,10H,5-6H2,1H3,(H,19,20)(H2,17,18,21)/p-1/t10-/m0/s1 |
| InChIKey | LIOIRKVULFDPGZ-JTQLQIEISA-M |
| XLogP | 1.70 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |