C14H19N2O3S- — CID 2004394
(2S)-2-[(2,5-dimethylphenyl)carbamoylamino]-4-methylsulfanylbutanoate (PubChem CID 2004394) has the molecular formula C14H19N2O3S- and a molecular weight of 295.38 g/mol. Its IUPAC name is (2S)-2-[(2,5-dimethylphenyl)carbamoylamino]-4-methylsulfanylbutanoate.
| Compound Name | (2S)-2-[(2,5-dimethylphenyl)carbamoylamino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 2004394 |
| Molecular Formula | C14H19N2O3S- |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | (2S)-2-[(2,5-dimethylphenyl)carbamoylamino]-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@H](NC(=O)Nc1cc(C)ccc1C)C(=O)[O-] |
| InChI | InChI=1S/C14H20N2O3S/c1-9-4-5-10(2)12(8-9)16-14(19)15-11(13(17)18)6-7-20-3/h4-5,8,11H,6-7H2,1-3H3,(H,17,18)(H2,15,16,19)/p-1/t11-/m0/s1 |
| InChIKey | HGULFCKIBBYICS-NSHDSACASA-M |
| XLogP | 1.30 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |