C12H17N3O3S — CID 63327509
2-[(4-methyl-3-pyridinyl)carbamoylamino]-4-methylsulfanylbutanoic acid (PubChem CID 63327509) has the molecular formula C12H17N3O3S and a molecular weight of 283.35 g/mol. Its IUPAC name is 2-[(4-methyl-3-pyridinyl)carbamoylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[(4-methyl-3-pyridinyl)carbamoylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 63327509 |
| Molecular Formula | C12H17N3O3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 2-[(4-methyl-3-pyridinyl)carbamoylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)Nc1cnccc1C)C(=O)O |
| InChI | InChI=1S/C12H17N3O3S/c1-8-3-5-13-7-10(8)15-12(18)14-9(11(16)17)4-6-19-2/h3,5,7,9H,4,6H2,1-2H3,(H,16,17)(H2,14,15,18) |
| InChIKey | AISYKKHDFDCFBD-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |