C13H19N3O3S — CID 104941436
(2R)-2-[(3-methyl-4-pyridinyl)methylcarbamoylamino]-4-methylsulfanylbutanoic acid (PubChem CID 104941436) has the molecular formula C13H19N3O3S and a molecular weight of 297.38 g/mol. Its IUPAC name is (2R)-2-[(3-methyl-4-pyridinyl)methylcarbamoylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2R)-2-[(3-methyl-4-pyridinyl)methylcarbamoylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 104941436 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | (2R)-2-[(3-methyl-4-pyridinyl)methylcarbamoylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@@H](NC(=O)NCc1ccncc1C)C(=O)O |
| InChI | InChI=1S/C13H19N3O3S/c1-9-7-14-5-3-10(9)8-15-13(19)16-11(12(17)18)4-6-20-2/h3,5,7,11H,4,6,8H2,1-2H3,(H,17,18)(H2,15,16,19)/t11-/m1/s1 |
| InChIKey | LGHMBLUJKWBCKH-LLVKDONJSA-N |
| XLogP | 1.40 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |