C12H17N3O3 — CID 114701374
2-methyl-3-[(3-methyl-4-pyridinyl)methylcarbamoylamino]propanoic acid (PubChem CID 114701374) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is 2-methyl-3-[(3-methyl-4-pyridinyl)methylcarbamoylamino]propanoic acid.
| Compound Name | 2-methyl-3-[(3-methyl-4-pyridinyl)methylcarbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 114701374 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 2-methyl-3-[(3-methyl-4-pyridinyl)methylcarbamoylamino]propanoic acid |
| SMILES | Cc1cnccc1CNC(=O)NCC(C)C(=O)O |
| InChI | InChI=1S/C12H17N3O3/c1-8-5-13-4-3-10(8)7-15-12(18)14-6-9(2)11(16)17/h3-5,9H,6-7H2,1-2H3,(H,16,17)(H2,14,15,18) |
| InChIKey | BGSNKYRAANIGJE-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |