C8H8N2O4S — CID 162715820
5-nitro-3,4-dihydro-1H-2λ6,1-benzothiazine 2,2-dioxide (PubChem CID 162715820) has the molecular formula C8H8N2O4S and a molecular weight of 228.23 g/mol. Its IUPAC name is 5-nitro-3,4-dihydro-1H-2λ6,1-benzothiazine 2,2-dioxide.
| Compound Name | 5-nitro-3,4-dihydro-1H-2λ6,1-benzothiazine 2,2-dioxide |
|---|---|
| PubChem CID | 162715820 |
| Molecular Formula | C8H8N2O4S |
| Molecular Weight | 228.23 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | 5-nitro-3,4-dihydro-1H-2λ6,1-benzothiazine 2,2-dioxide |
| SMILES | O=[N+]([O-])c1cccc2c1CCS(=O)(=O)N2 |
| InChI | InChI=1S/C8H8N2O4S/c11-10(12)8-3-1-2-7-6(8)4-5-15(13,14)9-7/h1-3,9H,4-5H2 |
| InChIKey | RLHNMKKOQHDXIC-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.23 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|