C9H7NO4 — CID 154380962
2-hydroxy-4-nitro-2,3-dihydroinden-1-one (PubChem CID 154380962) has the molecular formula C9H7NO4 and a molecular weight of 193.16 g/mol. Its IUPAC name is 2-hydroxy-4-nitro-2,3-dihydroinden-1-one.
| Compound Name | 2-hydroxy-4-nitro-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 154380962 |
| Molecular Formula | C9H7NO4 |
| Molecular Weight | 193.16 g/mol |
| Exact Mass | 193.04 |
| IUPAC Name | 2-hydroxy-4-nitro-2,3-dihydroinden-1-one |
| SMILES | O=C1c2cccc([N+](=O)[O-])c2CC1O |
| InChI | InChI=1S/C9H7NO4/c11-8-4-6-5(9(8)12)2-1-3-7(6)10(13)14/h1-3,8,11H,4H2 |
| InChIKey | SMMRDVBMSLTCMN-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.16 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|