C21H18N2O5 — CID 21350065
4-nitro-2-(4-piperidin-1-ylbenzoyl)indene-1,3-dione (PubChem CID 21350065) has the molecular formula C21H18N2O5 and a molecular weight of 378.38 g/mol. Its IUPAC name is 4-nitro-2-(4-piperidin-1-ylbenzoyl)indene-1,3-dione.
| Compound Name | 4-nitro-2-(4-piperidin-1-ylbenzoyl)indene-1,3-dione |
|---|---|
| PubChem CID | 21350065 |
| Molecular Formula | C21H18N2O5 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 4-nitro-2-(4-piperidin-1-ylbenzoyl)indene-1,3-dione |
| SMILES | O=C(c1ccc(N2CCCCC2)cc1)C1C(=O)c2cccc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C21H18N2O5/c24-19(13-7-9-14(10-8-13)22-11-2-1-3-12-22)18-20(25)15-5-4-6-16(23(27)28)17(15)21(18)26/h4-10,18H,1-3,11-12H2 |
| InChIKey | XQQLVLIHXCRPNX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|