C19H16N2O4 — CID 2846999
1-nitro-4-piperidin-1-ylanthracene-9,10-dione (PubChem CID 2846999) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is 1-nitro-4-piperidin-1-ylanthracene-9,10-dione.
| Compound Name | 1-nitro-4-piperidin-1-ylanthracene-9,10-dione |
|---|---|
| PubChem CID | 2846999 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 1-nitro-4-piperidin-1-ylanthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c([N+](=O)[O-])ccc(N3CCCCC3)c21 |
| InChI | InChI=1S/C19H16N2O4/c22-18-12-6-2-3-7-13(12)19(23)17-15(21(24)25)9-8-14(16(17)18)20-10-4-1-5-11-20/h2-3,6-9H,1,4-5,10-11H2 |
| InChIKey | SAWJRGSVGPDZCM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|