C25H25N3O7 — CID 20754883
tert-butyl 4-[4-(4-nitro-1,3-dioxoindene-2-carbonyl)phenyl]piperazine-1-carboxylate (PubChem CID 20754883) has the molecular formula C25H25N3O7 and a molecular weight of 479.49 g/mol. Its IUPAC name is tert-butyl 4-[4-(4-nitro-1,3-dioxoindene-2-carbonyl)phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(4-nitro-1,3-dioxoindene-2-carbonyl)phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 20754883 |
| Molecular Formula | C25H25N3O7 |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | tert-butyl 4-[4-(4-nitro-1,3-dioxoindene-2-carbonyl)phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(C(=O)C3C(=O)c4cccc([N+](=O)[O-])c4C3=O)cc2)CC1 |
| InChI | InChI=1S/C25H25N3O7/c1-25(2,3)35-24(32)27-13-11-26(12-14-27)16-9-7-15(8-10-16)21(29)20-22(30)17-5-4-6-18(28(33)34)19(17)23(20)31/h4-10,20H,11-14H2,1-3H3 |
| InChIKey | CODMOAUZHSAEMJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 127.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|