C23H28N4O6 — CID 174372630
4-[[3-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]anilino]methyl]-3-nitrobenzoic acid (PubChem CID 174372630) has the molecular formula C23H28N4O6 and a molecular weight of 456.50 g/mol. Its IUPAC name is 4-[[3-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]anilino]methyl]-3-nitrobenzoic acid.
| Compound Name | 4-[[3-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]anilino]methyl]-3-nitrobenzoic acid |
|---|---|
| PubChem CID | 174372630 |
| Molecular Formula | C23H28N4O6 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 4-[[3-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]anilino]methyl]-3-nitrobenzoic acid |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2cccc(NCc3ccc(C(=O)O)cc3[N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C23H28N4O6/c1-23(2,3)33-22(30)26-11-9-25(10-12-26)19-6-4-5-18(14-19)24-15-17-8-7-16(21(28)29)13-20(17)27(31)32/h4-8,13-14,24H,9-12,15H2,1-3H3,(H,28,29) |
| InChIKey | VTAZVRAWIGNGFU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 125.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|