C19H26N2O4 — CID 155669793
tert-butyl 4-[3-(2-methoxy-3-oxoprop-2-enyl)phenyl]piperazine-1-carboxylate (PubChem CID 155669793) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is tert-butyl 4-[3-(2-methoxy-3-oxoprop-2-enyl)phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(2-methoxy-3-oxoprop-2-enyl)phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 155669793 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | tert-butyl 4-[3-(2-methoxy-3-oxoprop-2-enyl)phenyl]piperazine-1-carboxylate |
| SMILES | COC(=C=O)Cc1cccc(N2CCN(C(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C19H26N2O4/c1-19(2,3)25-18(23)21-10-8-20(9-11-21)16-7-5-6-15(12-16)13-17(14-22)24-4/h5-7,12H,8-11,13H2,1-4H3 |
| InChIKey | BGGRJXVZGKKAKR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|