C22H19NO6 — CID 142952432
2-[4-(5-methyloxan-2-yl)benzoyl]-4-nitroindene-1,3-dione (PubChem CID 142952432) has the molecular formula C22H19NO6 and a molecular weight of 393.40 g/mol. Its IUPAC name is 2-[4-(5-methyloxan-2-yl)benzoyl]-4-nitroindene-1,3-dione.
| Compound Name | 2-[4-(5-methyloxan-2-yl)benzoyl]-4-nitroindene-1,3-dione |
|---|---|
| PubChem CID | 142952432 |
| Molecular Formula | C22H19NO6 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 2-[4-(5-methyloxan-2-yl)benzoyl]-4-nitroindene-1,3-dione |
| SMILES | CC1CCC(c2ccc(C(=O)C3C(=O)c4cccc([N+](=O)[O-])c4C3=O)cc2)OC1 |
| InChI | InChI=1S/C22H19NO6/c1-12-5-10-17(29-11-12)13-6-8-14(9-7-13)20(24)19-21(25)15-3-2-4-16(23(27)28)18(15)22(19)26/h2-4,6-9,12,17,19H,5,10-11H2,1H3 |
| InChIKey | XZMPTWCNCFALRR-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|