C9H6BrF2NO2 — CID 125485498
(2R)-2-bromo-3,3-difluoro-7-nitro-1,2-dihydroindene (PubChem CID 125485498) has the molecular formula C9H6BrF2NO2 and a molecular weight of 278.05 g/mol. Its IUPAC name is (2R)-2-bromo-3,3-difluoro-7-nitro-1,2-dihydroindene.
| Compound Name | (2R)-2-bromo-3,3-difluoro-7-nitro-1,2-dihydroindene |
|---|---|
| PubChem CID | 125485498 |
| Molecular Formula | C9H6BrF2NO2 |
| Molecular Weight | 278.05 g/mol |
| Exact Mass | 276.95 |
| IUPAC Name | (2R)-2-bromo-3,3-difluoro-7-nitro-1,2-dihydroindene |
| SMILES | O=[N+]([O-])c1cccc2c1C[C@@H](Br)C2(F)F |
| InChI | InChI=1S/C9H6BrF2NO2/c10-8-4-5-6(9(8,11)12)2-1-3-7(5)13(14)15/h1-3,8H,4H2/t8-/m1/s1 |
| InChIKey | RQPIGRZMNSYJLG-MRVPVSSYSA-N |
| XLogP | 3.01 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.05 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|