C10H12N2O4S — CID 97169062
[(2R)-4-nitro-2,3-dihydro-1H-inden-2-yl]methanesulfonamide (PubChem CID 97169062) has the molecular formula C10H12N2O4S and a molecular weight of 256.28 g/mol. Its IUPAC name is [(2R)-4-nitro-2,3-dihydro-1H-inden-2-yl]methanesulfonamide.
| Compound Name | [(2R)-4-nitro-2,3-dihydro-1H-inden-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 97169062 |
| Molecular Formula | C10H12N2O4S |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | [(2R)-4-nitro-2,3-dihydro-1H-inden-2-yl]methanesulfonamide |
| SMILES | NS(=O)(=O)C[C@@H]1Cc2cccc([N+](=O)[O-])c2C1 |
| InChI | InChI=1S/C10H12N2O4S/c11-17(15,16)6-7-4-8-2-1-3-10(12(13)14)9(8)5-7/h1-3,7H,4-6H2,(H2,11,15,16)/t7-/m1/s1 |
| InChIKey | XVVRFGHSKBTGGX-SSDOTTSWSA-N |
| XLogP | 0.60 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|