C13H16N2O4 — CID 68516274
(4-nitro-6,7,8,9-tetrahydro-5H-benzo[7]annulen-7-yl)methyl carbamate (PubChem CID 68516274) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is (4-nitro-6,7,8,9-tetrahydro-5H-benzo[7]annulen-7-yl)methyl carbamate.
| Compound Name | (4-nitro-6,7,8,9-tetrahydro-5H-benzo[7]annulen-7-yl)methyl carbamate |
|---|---|
| PubChem CID | 68516274 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | (4-nitro-6,7,8,9-tetrahydro-5H-benzo[7]annulen-7-yl)methyl carbamate |
| SMILES | NC(=O)OCC1CCc2cccc([N+](=O)[O-])c2CC1 |
| InChI | InChI=1S/C13H16N2O4/c14-13(16)19-8-9-4-6-10-2-1-3-12(15(17)18)11(10)7-5-9/h1-3,9H,4-8H2,(H2,14,16) |
| InChIKey | ZEDDCRLQOSEWEG-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|