C13H21N5O4 — CID 175548458
[1-[2-(2-methyl-5-nitroimidazol-1-yl)ethyl]piperidin-4-yl]methyl carbamate (PubChem CID 175548458) has the molecular formula C13H21N5O4 and a molecular weight of 311.34 g/mol. Its IUPAC name is [1-[2-(2-methyl-5-nitroimidazol-1-yl)ethyl]piperidin-4-yl]methyl carbamate.
| Compound Name | [1-[2-(2-methyl-5-nitroimidazol-1-yl)ethyl]piperidin-4-yl]methyl carbamate |
|---|---|
| PubChem CID | 175548458 |
| Molecular Formula | C13H21N5O4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | [1-[2-(2-methyl-5-nitroimidazol-1-yl)ethyl]piperidin-4-yl]methyl carbamate |
| SMILES | Cc1ncc([N+](=O)[O-])n1CCN1CCC(COC(N)=O)CC1 |
| InChI | InChI=1S/C13H21N5O4/c1-10-15-8-12(18(20)21)17(10)7-6-16-4-2-11(3-5-16)9-22-13(14)19/h8,11H,2-7,9H2,1H3,(H2,14,19) |
| InChIKey | RSZNPMLUYJBZQR-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 116.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|