C11H11NO4 — CID 95479919
methyl (2R)-4-nitro-2,3-dihydro-1H-indene-2-carboxylate (PubChem CID 95479919) has the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. Its IUPAC name is methyl (2R)-4-nitro-2,3-dihydro-1H-indene-2-carboxylate.
| Compound Name | methyl (2R)-4-nitro-2,3-dihydro-1H-indene-2-carboxylate |
|---|---|
| PubChem CID | 95479919 |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | methyl (2R)-4-nitro-2,3-dihydro-1H-indene-2-carboxylate |
| SMILES | COC(=O)[C@@H]1Cc2cccc([N+](=O)[O-])c2C1 |
| InChI | InChI=1S/C11H11NO4/c1-16-11(13)8-5-7-3-2-4-10(12(14)15)9(7)6-8/h2-4,8H,5-6H2,1H3/t8-/m1/s1 |
| InChIKey | KRHARWFTTQYZPM-MRVPVSSYSA-N |
| XLogP | 1.48 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|