C9H11ClN2O3 — CID 67553405
2-methoxy-4-nitro-1,3-dihydroisoindole;hydrochloride (PubChem CID 67553405) has the molecular formula C9H11ClN2O3 and a molecular weight of 230.65 g/mol. Its IUPAC name is 2-methoxy-4-nitro-1,3-dihydroisoindole;hydrochloride.
| Compound Name | 2-methoxy-4-nitro-1,3-dihydroisoindole;hydrochloride |
|---|---|
| PubChem CID | 67553405 |
| Molecular Formula | C9H11ClN2O3 |
| Molecular Weight | 230.65 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 2-methoxy-4-nitro-1,3-dihydroisoindole;hydrochloride |
| SMILES | CON1Cc2cccc([N+](=O)[O-])c2C1.Cl |
| InChI | InChI=1S/C9H10N2O3.ClH/c1-14-10-5-7-3-2-4-9(11(12)13)8(7)6-10;/h2-4H,5-6H2,1H3;1H |
| InChIKey | VHYMYKOFCGWTHU-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.65 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|