C17H18N2O3 — CID 133450332
5-methoxy-2-(4-methyl-2-nitrophenyl)-3,4-dihydro-1H-isoquinoline (PubChem CID 133450332) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is 5-methoxy-2-(4-methyl-2-nitrophenyl)-3,4-dihydro-1H-isoquinoline.
| Compound Name | 5-methoxy-2-(4-methyl-2-nitrophenyl)-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 133450332 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 5-methoxy-2-(4-methyl-2-nitrophenyl)-3,4-dihydro-1H-isoquinoline |
| SMILES | COc1cccc2c1CCN(c1ccc(C)cc1[N+](=O)[O-])C2 |
| InChI | InChI=1S/C17H18N2O3/c1-12-6-7-15(16(10-12)19(20)21)18-9-8-14-13(11-18)4-3-5-17(14)22-2/h3-7,10H,8-9,11H2,1-2H3 |
| InChIKey | JSGQBSKQEIRQOP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|