C21H21N3O4 — CID 133436232
4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-methyl-8-nitroquinoline (PubChem CID 133436232) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is 4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-methyl-8-nitroquinoline.
| Compound Name | 4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-methyl-8-nitroquinoline |
|---|---|
| PubChem CID | 133436232 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-methyl-8-nitroquinoline |
| SMILES | COc1cc2c(cc1OC)CN(c1cc(C)nc3c([N+](=O)[O-])cccc13)CC2 |
| InChI | InChI=1S/C21H21N3O4/c1-13-9-18(16-5-4-6-17(24(25)26)21(16)22-13)23-8-7-14-10-19(27-2)20(28-3)11-15(14)12-23/h4-6,9-11H,7-8,12H2,1-3H3 |
| InChIKey | WEBRHBBUAHRTHX-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|