C16H19N3O3 — CID 133436658
2,2-dimethyl-4-(2-methyl-8-nitroquinolin-4-yl)morpholine (PubChem CID 133436658) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is 2,2-dimethyl-4-(2-methyl-8-nitroquinolin-4-yl)morpholine.
| Compound Name | 2,2-dimethyl-4-(2-methyl-8-nitroquinolin-4-yl)morpholine |
|---|---|
| PubChem CID | 133436658 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 2,2-dimethyl-4-(2-methyl-8-nitroquinolin-4-yl)morpholine |
| SMILES | Cc1cc(N2CCOC(C)(C)C2)c2cccc([N+](=O)[O-])c2n1 |
| InChI | InChI=1S/C16H19N3O3/c1-11-9-14(18-7-8-22-16(2,3)10-18)12-5-4-6-13(19(20)21)15(12)17-11/h4-6,9H,7-8,10H2,1-3H3 |
| InChIKey | AGYKJVUPLXJBET-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|