C18H19N5O2 — CID 133436964
2-methyl-8-nitro-4-(4-pyrazol-1-ylpiperidin-1-yl)quinoline (PubChem CID 133436964) has the molecular formula C18H19N5O2 and a molecular weight of 337.38 g/mol. Its IUPAC name is 2-methyl-8-nitro-4-(4-pyrazol-1-ylpiperidin-1-yl)quinoline.
| Compound Name | 2-methyl-8-nitro-4-(4-pyrazol-1-ylpiperidin-1-yl)quinoline |
|---|---|
| PubChem CID | 133436964 |
| Molecular Formula | C18H19N5O2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 2-methyl-8-nitro-4-(4-pyrazol-1-ylpiperidin-1-yl)quinoline |
| SMILES | Cc1cc(N2CCC(n3cccn3)CC2)c2cccc([N+](=O)[O-])c2n1 |
| InChI | InChI=1S/C18H19N5O2/c1-13-12-17(15-4-2-5-16(23(24)25)18(15)20-13)21-10-6-14(7-11-21)22-9-3-8-19-22/h2-5,8-9,12,14H,6-7,10-11H2,1H3 |
| InChIKey | UDLULHOQFSJWEB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 77.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|