C18H24N4O4S — CID 133437308
N-ethyl-N-[1-(2-methyl-8-nitroquinolin-4-yl)piperidin-4-yl]methanesulfonamide (PubChem CID 133437308) has the molecular formula C18H24N4O4S and a molecular weight of 392.48 g/mol. Its IUPAC name is N-ethyl-N-[1-(2-methyl-8-nitroquinolin-4-yl)piperidin-4-yl]methanesulfonamide.
| Compound Name | N-ethyl-N-[1-(2-methyl-8-nitroquinolin-4-yl)piperidin-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 133437308 |
| Molecular Formula | C18H24N4O4S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | N-ethyl-N-[1-(2-methyl-8-nitroquinolin-4-yl)piperidin-4-yl]methanesulfonamide |
| SMILES | CCN(C1CCN(c2cc(C)nc3c([N+](=O)[O-])cccc23)CC1)S(C)(=O)=O |
| InChI | InChI=1S/C18H24N4O4S/c1-4-21(27(3,25)26)14-8-10-20(11-9-14)17-12-13(2)19-18-15(17)6-5-7-16(18)22(23)24/h5-7,12,14H,4,8-11H2,1-3H3 |
| InChIKey | XTQQLHQVJSJQPA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 96.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|