C23H24N4O4 — CID 133436640
N-(2-methoxyphenyl)-1-(2-methyl-8-nitroquinolin-4-yl)piperidine-4-carboxamide (PubChem CID 133436640) has the molecular formula C23H24N4O4 and a molecular weight of 420.47 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-1-(2-methyl-8-nitroquinolin-4-yl)piperidine-4-carboxamide.
| Compound Name | N-(2-methoxyphenyl)-1-(2-methyl-8-nitroquinolin-4-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 133436640 |
| Molecular Formula | C23H24N4O4 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | N-(2-methoxyphenyl)-1-(2-methyl-8-nitroquinolin-4-yl)piperidine-4-carboxamide |
| SMILES | COc1ccccc1NC(=O)C1CCN(c2cc(C)nc3c([N+](=O)[O-])cccc23)CC1 |
| InChI | InChI=1S/C23H24N4O4/c1-15-14-20(17-6-5-8-19(27(29)30)22(17)24-15)26-12-10-16(11-13-26)23(28)25-18-7-3-4-9-21(18)31-2/h3-9,14,16H,10-13H2,1-2H3,(H,25,28) |
| InChIKey | OHUSLDKCSHBMMR-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|