C18H16BrN3O4 — CID 133325141
3-[2-(4-bromo-2-nitrophenyl)-3,4-dihydro-1H-isoquinolin-5-yl]-1,3-oxazolidin-2-one (PubChem CID 133325141) has the molecular formula C18H16BrN3O4 and a molecular weight of 418.25 g/mol. Its IUPAC name is 3-[2-(4-bromo-2-nitrophenyl)-3,4-dihydro-1H-isoquinolin-5-yl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[2-(4-bromo-2-nitrophenyl)-3,4-dihydro-1H-isoquinolin-5-yl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 133325141 |
| Molecular Formula | C18H16BrN3O4 |
| Molecular Weight | 418.25 g/mol |
| Exact Mass | 417.03 |
| IUPAC Name | 3-[2-(4-bromo-2-nitrophenyl)-3,4-dihydro-1H-isoquinolin-5-yl]-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1c1cccc2c1CCN(c1ccc(Br)cc1[N+](=O)[O-])C2 |
| InChI | InChI=1S/C18H16BrN3O4/c19-13-4-5-16(17(10-13)22(24)25)20-7-6-14-12(11-20)2-1-3-15(14)21-8-9-26-18(21)23/h1-5,10H,6-9,11H2 |
| InChIKey | PXPYGWMLJPFCIC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.25 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|