C18H19N3O5 — CID 133450637
ethyl 2-(5-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)-3-nitropyridine-4-carboxylate (PubChem CID 133450637) has the molecular formula C18H19N3O5 and a molecular weight of 357.37 g/mol. Its IUPAC name is ethyl 2-(5-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)-3-nitropyridine-4-carboxylate.
| Compound Name | ethyl 2-(5-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)-3-nitropyridine-4-carboxylate |
|---|---|
| PubChem CID | 133450637 |
| Molecular Formula | C18H19N3O5 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | ethyl 2-(5-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)-3-nitropyridine-4-carboxylate |
| SMILES | CCOC(=O)c1ccnc(N2CCc3c(cccc3OC)C2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H19N3O5/c1-3-26-18(22)14-7-9-19-17(16(14)21(23)24)20-10-8-13-12(11-20)5-4-6-15(13)25-2/h4-7,9H,3,8,10-11H2,1-2H3 |
| InChIKey | YLZZZIYAPJQBSD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 94.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|