C18H21N5O4 — CID 23489486
ethyl 2-[(5-nitro-6-piperidin-1-ylpyrimidin-4-yl)amino]benzoate (PubChem CID 23489486) has the molecular formula C18H21N5O4 and a molecular weight of 371.40 g/mol. Its IUPAC name is ethyl 2-[(5-nitro-6-piperidin-1-ylpyrimidin-4-yl)amino]benzoate.
| Compound Name | ethyl 2-[(5-nitro-6-piperidin-1-ylpyrimidin-4-yl)amino]benzoate |
|---|---|
| PubChem CID | 23489486 |
| Molecular Formula | C18H21N5O4 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | ethyl 2-[(5-nitro-6-piperidin-1-ylpyrimidin-4-yl)amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1Nc1ncnc(N2CCCCC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H21N5O4/c1-2-27-18(24)13-8-4-5-9-14(13)21-16-15(23(25)26)17(20-12-19-16)22-10-6-3-7-11-22/h4-5,8-9,12H,2-3,6-7,10-11H2,1H3,(H,19,20,21) |
| InChIKey | JWPONOVYGXETTF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|