C16H17N5O5 — CID 23489555
methyl 2-[(6-morpholin-4-yl-5-nitropyrimidin-4-yl)amino]benzoate (PubChem CID 23489555) has the molecular formula C16H17N5O5 and a molecular weight of 359.34 g/mol. Its IUPAC name is methyl 2-[(6-morpholin-4-yl-5-nitropyrimidin-4-yl)amino]benzoate.
| Compound Name | methyl 2-[(6-morpholin-4-yl-5-nitropyrimidin-4-yl)amino]benzoate |
|---|---|
| PubChem CID | 23489555 |
| Molecular Formula | C16H17N5O5 |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | methyl 2-[(6-morpholin-4-yl-5-nitropyrimidin-4-yl)amino]benzoate |
| SMILES | COC(=O)c1ccccc1Nc1ncnc(N2CCOCC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H17N5O5/c1-25-16(22)11-4-2-3-5-12(11)19-14-13(21(23)24)15(18-10-17-14)20-6-8-26-9-7-20/h2-5,10H,6-9H2,1H3,(H,17,18,19) |
| InChIKey | YTGAXQVMBJOZHU-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 119.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|