C22H27N5O4 — CID 23492789
methyl 2-[[5-nitro-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidin-4-yl]amino]benzoate (PubChem CID 23492789) has the molecular formula C22H27N5O4 and a molecular weight of 425.49 g/mol. Its IUPAC name is methyl 2-[[5-nitro-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidin-4-yl]amino]benzoate.
| Compound Name | methyl 2-[[5-nitro-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 23492789 |
| Molecular Formula | C22H27N5O4 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | methyl 2-[[5-nitro-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidin-4-yl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1Nc1ncnc(N2CC3(C)CC2CC(C)(C)C3)c1[N+](=O)[O-] |
| InChI | InChI=1S/C22H27N5O4/c1-21(2)9-14-10-22(3,11-21)12-26(14)19-17(27(29)30)18(23-13-24-19)25-16-8-6-5-7-15(16)20(28)31-4/h5-8,13-14H,9-12H2,1-4H3,(H,23,24,25) |
| InChIKey | JBGCYNIJZOLHBT-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|