C29H30Cl2N6O2 — CID 23483068
2-[2-chloro-5-methyl-4-[[5-nitro-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidin-4-yl]amino]phenyl]-2-(4-chlorophenyl)acetonitrile (PubChem CID 23483068) has the molecular formula C29H30Cl2N6O2 and a molecular weight of 565.51 g/mol. Its IUPAC name is 2-[2-chloro-5-methyl-4-[[5-nitro-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidin-4-yl]amino]phenyl]-2-(4-chlorophenyl)acetonitrile.
| Compound Name | 2-[2-chloro-5-methyl-4-[[5-nitro-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidin-4-yl]amino]phenyl]-2-(4-chlorophenyl)acetonitrile |
|---|---|
| PubChem CID | 23483068 |
| Molecular Formula | C29H30Cl2N6O2 |
| Molecular Weight | 565.51 g/mol |
| Exact Mass | 564.18 |
| IUPAC Name | 2-[2-chloro-5-methyl-4-[[5-nitro-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidin-4-yl]amino]phenyl]-2-(4-chlorophenyl)acetonitrile |
| SMILES | Cc1cc(C(C#N)c2ccc(Cl)cc2)c(Cl)cc1Nc1ncnc(N2CC3(C)CC2CC(C)(C)C3)c1[N+](=O)[O-] |
| InChI | InChI=1S/C29H30Cl2N6O2/c1-17-9-21(22(13-32)18-5-7-19(30)8-6-18)23(31)10-24(17)35-26-25(37(38)39)27(34-16-33-26)36-15-29(4)12-20(36)11-28(2,3)14-29/h5-10,16,20,22H,11-12,14-15H2,1-4H3,(H,33,34,35) |
| InChIKey | CSRSADBTXCBCGR-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 107.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.51 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|