C25H16Cl3FN6O2 — CID 23483189
2-[2-chloro-4-[[6-(3-chloro-4-fluoroanilino)-5-nitropyrimidin-4-yl]amino]-5-methylphenyl]-2-(4-chlorophenyl)acetonitrile (PubChem CID 23483189) has the molecular formula C25H16Cl3FN6O2 and a molecular weight of 557.80 g/mol. Its IUPAC name is 2-[2-chloro-4-[[6-(3-chloro-4-fluoroanilino)-5-nitropyrimidin-4-yl]amino]-5-methylphenyl]-2-(4-chlorophenyl)acetonitrile.
| Compound Name | 2-[2-chloro-4-[[6-(3-chloro-4-fluoroanilino)-5-nitropyrimidin-4-yl]amino]-5-methylphenyl]-2-(4-chlorophenyl)acetonitrile |
|---|---|
| PubChem CID | 23483189 |
| Molecular Formula | C25H16Cl3FN6O2 |
| Molecular Weight | 557.80 g/mol |
| Exact Mass | 556.04 |
| IUPAC Name | 2-[2-chloro-4-[[6-(3-chloro-4-fluoroanilino)-5-nitropyrimidin-4-yl]amino]-5-methylphenyl]-2-(4-chlorophenyl)acetonitrile |
| SMILES | Cc1cc(C(C#N)c2ccc(Cl)cc2)c(Cl)cc1Nc1ncnc(Nc2ccc(F)c(Cl)c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C25H16Cl3FN6O2/c1-13-8-17(18(11-30)14-2-4-15(26)5-3-14)19(27)10-22(13)34-25-23(35(36)37)24(31-12-32-25)33-16-6-7-21(29)20(28)9-16/h2-10,12,18H,1H3,(H2,31,32,33,34) |
| InChIKey | OJPFJCICRRIHHV-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 116.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.80 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|