C28H24Cl2N8O2 — CID 23483200
2-[2-chloro-5-methyl-4-[[5-nitro-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-yl]amino]phenyl]-2-(4-chlorophenyl)acetonitrile (PubChem CID 23483200) has the molecular formula C28H24Cl2N8O2 and a molecular weight of 575.46 g/mol. Its IUPAC name is 2-[2-chloro-5-methyl-4-[[5-nitro-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-yl]amino]phenyl]-2-(4-chlorophenyl)acetonitrile.
| Compound Name | 2-[2-chloro-5-methyl-4-[[5-nitro-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-yl]amino]phenyl]-2-(4-chlorophenyl)acetonitrile |
|---|---|
| PubChem CID | 23483200 |
| Molecular Formula | C28H24Cl2N8O2 |
| Molecular Weight | 575.46 g/mol |
| Exact Mass | 574.14 |
| IUPAC Name | 2-[2-chloro-5-methyl-4-[[5-nitro-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-yl]amino]phenyl]-2-(4-chlorophenyl)acetonitrile |
| SMILES | Cc1cc(C(C#N)c2ccc(Cl)cc2)c(Cl)cc1Nc1ncnc(N2CCN(c3ccccn3)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C28H24Cl2N8O2/c1-18-14-21(22(16-31)19-5-7-20(29)8-6-19)23(30)15-24(18)35-27-26(38(39)40)28(34-17-33-27)37-12-10-36(11-13-37)25-4-2-3-9-32-25/h2-9,14-15,17,22H,10-13H2,1H3,(H,33,34,35) |
| InChIKey | PIKFHSMRKJVBKI-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 124.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.46 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|